About methyl 3-methylbutanoate
methyl 3-methylbutanoate (PubChem CID 11160) has the molecular formula C6H12O2
and a molecular weight of 116.16 g/mol. Its IUPAC name is methyl 3-methylbutanoate.
Molecular Properties
| Compound Name | methyl 3-methylbutanoate |
| PubChem CID | 11160 |
| Molecular Formula | C6H12O2 |
| Molecular Weight | 116.16 g/mol |
| Exact Mass | 116.08 |
| IUPAC Name | methyl 3-methylbutanoate |
| SMILES | COC(=O)CC(C)C |
| InChI | InChI=1S/C6H12O2/c1-5(2)4-6(7)8-3/h5H,4H2,1-3H3 |
| InChIKey | OQAGVSWESNCJJT-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.16 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methyl 3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-methylbutanoate?
The IUPAC name of methyl 3-methylbutanoate (CID 11160) is methyl 3-methylbutanoate.
What is the SMILES notation for methyl 3-methylbutanoate?
The canonical SMILES for methyl 3-methylbutanoate is COC(=O)CC(C)C.
What is the InChIKey of methyl 3-methylbutanoate?
The InChIKey is OQAGVSWESNCJJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O2/c1-5(2)4-6(7)8-3/h5H,4H2,1-3H3.
What are the key properties of methyl 3-methylbutanoate?
methyl 3-methylbutanoate has a molecular weight of 116.16 g/mol, XLogP of 1.21, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-methylbutanoate is sourced from PubChem (CID 11160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).