C23H28N4O2 — CID 111603099
2-[[ethylamino-[(3-methyl-1-benzofuran-2-yl)methylamino]methylidene]amino]-N-(2-phenylethyl)acetamide (PubChem CID 111603099) has the molecular formula C23H28N4O2 and a molecular weight of 392.50 g/mol. Its IUPAC name is 2-[[ethylamino-[(3-methyl-1-benzofuran-2-yl)methylamino]methylidene]amino]-N-(2-phenylethyl)acetamide.
| Compound Name | 2-[[ethylamino-[(3-methyl-1-benzofuran-2-yl)methylamino]methylidene]amino]-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 111603099 |
| Molecular Formula | C23H28N4O2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 2-[[ethylamino-[(3-methyl-1-benzofuran-2-yl)methylamino]methylidene]amino]-N-(2-phenylethyl)acetamide |
| SMILES | CCN/C(=N\CC(=O)NCCc1ccccc1)NCc1oc2ccccc2c1C |
| InChI | InChI=1S/C23H28N4O2/c1-3-24-23(26-15-21-17(2)19-11-7-8-12-20(19)29-21)27-16-22(28)25-14-13-18-9-5-4-6-10-18/h4-12H,3,13-16H2,1-2H3,(H,25,28)(H2,24,26,27) |
| InChIKey | MWNPWQFANVTDKU-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 78.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|