C20H23N5O2 — CID 111602675
2-[[ethylamino-[(3-methyl-1-benzofuran-2-yl)methylamino]methylidene]amino]-N-pyridin-3-ylacetamide (PubChem CID 111602675) has the molecular formula C20H23N5O2 and a molecular weight of 365.44 g/mol. Its IUPAC name is 2-[[ethylamino-[(3-methyl-1-benzofuran-2-yl)methylamino]methylidene]amino]-N-pyridin-3-ylacetamide.
| Compound Name | 2-[[ethylamino-[(3-methyl-1-benzofuran-2-yl)methylamino]methylidene]amino]-N-pyridin-3-ylacetamide |
|---|---|
| PubChem CID | 111602675 |
| Molecular Formula | C20H23N5O2 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 2-[[ethylamino-[(3-methyl-1-benzofuran-2-yl)methylamino]methylidene]amino]-N-pyridin-3-ylacetamide |
| SMILES | CCN/C(=N\CC(=O)Nc1cccnc1)NCc1oc2ccccc2c1C |
| InChI | InChI=1S/C20H23N5O2/c1-3-22-20(24-13-19(26)25-15-7-6-10-21-11-15)23-12-18-14(2)16-8-4-5-9-17(16)27-18/h4-11H,3,12-13H2,1-2H3,(H,25,26)(H2,22,23,24) |
| InChIKey | KUJDGPVYVORFLX-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|