C21H31IN4O2 — CID 111605378
1-ethyl-3-(2-methoxy-2-methylpropyl)-2-[[4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]guanidine;hydroiodide (PubChem CID 111605378) has the molecular formula C21H31IN4O2 and a molecular weight of 498.41 g/mol. Its IUPAC name is 1-ethyl-3-(2-methoxy-2-methylpropyl)-2-[[4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(2-methoxy-2-methylpropyl)-2-[[4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111605378 |
| Molecular Formula | C21H31IN4O2 |
| Molecular Weight | 498.41 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | 1-ethyl-3-(2-methoxy-2-methylpropyl)-2-[[4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(Cn2ccccc2=O)cc1)NCC(C)(C)OC.I |
| InChI | InChI=1S/C21H30N4O2.HI/c1-5-22-20(24-16-21(2,3)27-4)23-14-17-9-11-18(12-10-17)15-25-13-7-6-8-19(25)26;/h6-13H,5,14-16H2,1-4H3,(H2,22,23,24);1H |
| InChIKey | OMSDMKDBMGNHLX-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 67.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.41 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|