C23H35N5O2 — CID 111650724
1-ethyl-3-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-[[4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]guanidine (PubChem CID 111650724) has the molecular formula C23H35N5O2 and a molecular weight of 413.57 g/mol. Its IUPAC name is 1-ethyl-3-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-[[4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-[[4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111650724 |
| Molecular Formula | C23H35N5O2 |
| Molecular Weight | 413.57 g/mol |
| Exact Mass | 413.28 |
| IUPAC Name | 1-ethyl-3-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-[[4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(Cn2ccccc2=O)cc1)NCCN(C)CCCOC |
| InChI | InChI=1S/C23H35N5O2/c1-4-24-23(25-13-16-27(2)14-7-17-30-3)26-18-20-9-11-21(12-10-20)19-28-15-6-5-8-22(28)29/h5-6,8-12,15H,4,7,13-14,16-19H2,1-3H3,(H2,24,25,26) |
| InChIKey | GERJMAPPBXEUSU-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 70.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.57 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|