C14H14O3 — CID 11160572
(1'S,2'R,5R,7'S,8'R)-spiro[oxolane-5,6'-tricyclo[6.2.1.02,7]undeca-4,9-diene]-2,3'-dione (PubChem CID 11160572) has the molecular formula C14H14O3 and a molecular weight of 230.26 g/mol. Its IUPAC name is (1'S,2'R,5R,7'S,8'R)-spiro[oxolane-5,6'-tricyclo[6.2.1.02,7]undeca-4,9-diene]-2,3'-dione.
| Compound Name | (1'S,2'R,5R,7'S,8'R)-spiro[oxolane-5,6'-tricyclo[6.2.1.02,7]undeca-4,9-diene]-2,3'-dione |
|---|---|
| PubChem CID | 11160572 |
| Molecular Formula | C14H14O3 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | (1'S,2'R,5R,7'S,8'R)-spiro[oxolane-5,6'-tricyclo[6.2.1.02,7]undeca-4,9-diene]-2,3'-dione |
| SMILES | O=C1CC[C@]2(C=CC(=O)[C@H]3[C@@H]2[C@H]2C=C[C@@H]3C2)O1 |
| InChI | InChI=1S/C14H14O3/c15-10-3-5-14(6-4-11(16)17-14)13-9-2-1-8(7-9)12(10)13/h1-3,5,8-9,12-13H,4,6-7H2/t8-,9+,12+,13+,14+/m1/s1 |
| InChIKey | CLXYVEQBFUPYGH-LKKYHPLOSA-N |
| XLogP | 1.64 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|