C12H23IN4OS — CID 111605988
1-(2-methoxy-2-methylpropyl)-2-methyl-3-[(4-methyl-1,3-thiazol-5-yl)methyl]guanidine;hydroiodide (PubChem CID 111605988) has the molecular formula C12H23IN4OS and a molecular weight of 398.31 g/mol. Its IUPAC name is 1-(2-methoxy-2-methylpropyl)-2-methyl-3-[(4-methyl-1,3-thiazol-5-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(2-methoxy-2-methylpropyl)-2-methyl-3-[(4-methyl-1,3-thiazol-5-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111605988 |
| Molecular Formula | C12H23IN4OS |
| Molecular Weight | 398.31 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | 1-(2-methoxy-2-methylpropyl)-2-methyl-3-[(4-methyl-1,3-thiazol-5-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1scnc1C)NCC(C)(C)OC.I |
| InChI | InChI=1S/C12H22N4OS.HI/c1-9-10(18-8-16-9)6-14-11(13-4)15-7-12(2,3)17-5;/h8H,6-7H2,1-5H3,(H2,13,14,15);1H |
| InChIKey | JZEGCNNJCVKOPD-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.31 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|