C14H22N4O2S — CID 111609222
2-methyl-1-(2-methyl-2-methylsulfanylpropyl)-3-[(2-nitrophenyl)methyl]guanidine (PubChem CID 111609222) has the molecular formula C14H22N4O2S and a molecular weight of 310.42 g/mol. Its IUPAC name is 2-methyl-1-(2-methyl-2-methylsulfanylpropyl)-3-[(2-nitrophenyl)methyl]guanidine.
| Compound Name | 2-methyl-1-(2-methyl-2-methylsulfanylpropyl)-3-[(2-nitrophenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111609222 |
| Molecular Formula | C14H22N4O2S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 2-methyl-1-(2-methyl-2-methylsulfanylpropyl)-3-[(2-nitrophenyl)methyl]guanidine |
| SMILES | C/N=C(/NCc1ccccc1[N+](=O)[O-])NCC(C)(C)SC |
| InChI | InChI=1S/C14H22N4O2S/c1-14(2,21-4)10-17-13(15-3)16-9-11-7-5-6-8-12(11)18(19)20/h5-8H,9-10H2,1-4H3,(H2,15,16,17) |
| InChIKey | BUNSLAOQHMUIFS-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 79.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|