C15H34N4S — CID 111611158
2-[3-(dimethylamino)-2,2-dimethylpropyl]-1-ethyl-3-(2-methyl-2-methylsulfanylpropyl)guanidine (PubChem CID 111611158) has the molecular formula C15H34N4S and a molecular weight of 302.53 g/mol. Its IUPAC name is 2-[3-(dimethylamino)-2,2-dimethylpropyl]-1-ethyl-3-(2-methyl-2-methylsulfanylpropyl)guanidine.
| Compound Name | 2-[3-(dimethylamino)-2,2-dimethylpropyl]-1-ethyl-3-(2-methyl-2-methylsulfanylpropyl)guanidine |
|---|---|
| PubChem CID | 111611158 |
| Molecular Formula | C15H34N4S |
| Molecular Weight | 302.53 g/mol |
| Exact Mass | 302.25 |
| IUPAC Name | 2-[3-(dimethylamino)-2,2-dimethylpropyl]-1-ethyl-3-(2-methyl-2-methylsulfanylpropyl)guanidine |
| SMILES | CCN/C(=N\CC(C)(C)CN(C)C)NCC(C)(C)SC |
| InChI | InChI=1S/C15H34N4S/c1-9-16-13(18-11-15(4,5)20-8)17-10-14(2,3)12-19(6)7/h9-12H2,1-8H3,(H2,16,17,18) |
| InChIKey | XPLYIVLIIUEUDS-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.53 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|