C13H29IN4OS — CID 111609393
3-[[N-ethyl-N'-(2-methyl-2-methylsulfanylpropyl)carbamimidoyl]amino]-N,N-dimethylpropanamide;hydroiodide (PubChem CID 111609393) has the molecular formula C13H29IN4OS and a molecular weight of 416.37 g/mol. Its IUPAC name is 3-[[N-ethyl-N'-(2-methyl-2-methylsulfanylpropyl)carbamimidoyl]amino]-N,N-dimethylpropanamide;hydroiodide.
| Compound Name | 3-[[N-ethyl-N'-(2-methyl-2-methylsulfanylpropyl)carbamimidoyl]amino]-N,N-dimethylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111609393 |
| Molecular Formula | C13H29IN4OS |
| Molecular Weight | 416.37 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | 3-[[N-ethyl-N'-(2-methyl-2-methylsulfanylpropyl)carbamimidoyl]amino]-N,N-dimethylpropanamide;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(C)SC)NCCC(=O)N(C)C.I |
| InChI | InChI=1S/C13H28N4OS.HI/c1-7-14-12(16-10-13(2,3)19-6)15-9-8-11(18)17(4)5;/h7-10H2,1-6H3,(H2,14,15,16);1H |
| InChIKey | YCGJJHJFHPJILP-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.37 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|