C17H27F2N3O2S — CID 111611300
2-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-1-ethyl-3-(2-methyl-2-methylsulfanylpropyl)guanidine (PubChem CID 111611300) has the molecular formula C17H27F2N3O2S and a molecular weight of 375.49 g/mol. Its IUPAC name is 2-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-1-ethyl-3-(2-methyl-2-methylsulfanylpropyl)guanidine.
| Compound Name | 2-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-1-ethyl-3-(2-methyl-2-methylsulfanylpropyl)guanidine |
|---|---|
| PubChem CID | 111611300 |
| Molecular Formula | C17H27F2N3O2S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 2-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-1-ethyl-3-(2-methyl-2-methylsulfanylpropyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccc(OC)c(OC(F)F)c1)NCC(C)(C)SC |
| InChI | InChI=1S/C17H27F2N3O2S/c1-6-20-16(22-11-17(2,3)25-5)21-10-12-7-8-13(23-4)14(9-12)24-15(18)19/h7-9,15H,6,10-11H2,1-5H3,(H2,20,21,22) |
| InChIKey | VCTWSIADNPSNKK-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|