C20H33F2IN4O4 — CID 111887440
tert-butyl N-[3-[[N'-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-N-ethylcarbamimidoyl]amino]propyl]carbamate;hydroiodide (PubChem CID 111887440) has the molecular formula C20H33F2IN4O4 and a molecular weight of 558.41 g/mol. Its IUPAC name is tert-butyl N-[3-[[N'-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-N-ethylcarbamimidoyl]amino]propyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[3-[[N'-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-N-ethylcarbamimidoyl]amino]propyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111887440 |
| Molecular Formula | C20H33F2IN4O4 |
| Molecular Weight | 558.41 g/mol |
| Exact Mass | 558.15 |
| IUPAC Name | tert-butyl N-[3-[[N'-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-N-ethylcarbamimidoyl]amino]propyl]carbamate;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(OC)c(OC(F)F)c1)NCCCNC(=O)OC(C)(C)C.I |
| InChI | InChI=1S/C20H32F2N4O4.HI/c1-6-23-18(24-10-7-11-25-19(27)30-20(2,3)4)26-13-14-8-9-15(28-5)16(12-14)29-17(21)22;/h8-9,12,17H,6-7,10-11,13H2,1-5H3,(H,25,27)(H2,23,24,26);1H |
| InChIKey | LLKPXUUZHUVYIT-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.41 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|