C21H37IN4O4 — CID 111885684
tert-butyl N-[2-[[N-ethyl-N'-[(3-methoxy-4-propoxyphenyl)methyl]carbamimidoyl]amino]ethyl]carbamate;hydroiodide (PubChem CID 111885684) has the molecular formula C21H37IN4O4 and a molecular weight of 536.46 g/mol. Its IUPAC name is tert-butyl N-[2-[[N-ethyl-N'-[(3-methoxy-4-propoxyphenyl)methyl]carbamimidoyl]amino]ethyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[2-[[N-ethyl-N'-[(3-methoxy-4-propoxyphenyl)methyl]carbamimidoyl]amino]ethyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111885684 |
| Molecular Formula | C21H37IN4O4 |
| Molecular Weight | 536.46 g/mol |
| Exact Mass | 536.19 |
| IUPAC Name | tert-butyl N-[2-[[N-ethyl-N'-[(3-methoxy-4-propoxyphenyl)methyl]carbamimidoyl]amino]ethyl]carbamate;hydroiodide |
| SMILES | CCCOc1ccc(C/N=C(\NCC)NCCNC(=O)OC(C)(C)C)cc1OC.I |
| InChI | InChI=1S/C21H36N4O4.HI/c1-7-13-28-17-10-9-16(14-18(17)27-6)15-25-19(22-8-2)23-11-12-24-20(26)29-21(3,4)5;/h9-10,14H,7-8,11-13,15H2,1-6H3,(H,24,26)(H2,22,23,25);1H |
| InChIKey | YYWJMWISYZQAIS-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.46 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|