C14H16N4O — CID 11161171
2,5-diazabicyclo[2.2.2]octan-2-yl(1H-indazol-3-yl)methanone (PubChem CID 11161171) has the molecular formula C14H16N4O and a molecular weight of 256.31 g/mol. Its IUPAC name is 2,5-diazabicyclo[2.2.2]octan-2-yl(1H-indazol-3-yl)methanone.
| Compound Name | 2,5-diazabicyclo[2.2.2]octan-2-yl(1H-indazol-3-yl)methanone |
|---|---|
| PubChem CID | 11161171 |
| Molecular Formula | C14H16N4O |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 2,5-diazabicyclo[2.2.2]octan-2-yl(1H-indazol-3-yl)methanone |
| SMILES | O=C(c1n[nH]c2ccccc12)N1CC2CCC1CN2 |
| InChI | InChI=1S/C14H16N4O/c19-14(18-8-9-5-6-10(18)7-15-9)13-11-3-1-2-4-12(11)16-17-13/h1-4,9-10,15H,5-8H2,(H,16,17) |
| InChIKey | PUVODPHOTXITPG-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |