C13H14N4O — CID 69289370
2,5-diazabicyclo[2.2.1]heptan-2-yl(1H-indazol-3-yl)methanone (PubChem CID 69289370) has the molecular formula C13H14N4O and a molecular weight of 242.28 g/mol. Its IUPAC name is 2,5-diazabicyclo[2.2.1]heptan-2-yl(1H-indazol-3-yl)methanone.
| Compound Name | 2,5-diazabicyclo[2.2.1]heptan-2-yl(1H-indazol-3-yl)methanone |
|---|---|
| PubChem CID | 69289370 |
| Molecular Formula | C13H14N4O |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 2,5-diazabicyclo[2.2.1]heptan-2-yl(1H-indazol-3-yl)methanone |
| SMILES | O=C(c1n[nH]c2ccccc12)N1CC2CC1CN2 |
| InChI | InChI=1S/C13H14N4O/c18-13(17-7-8-5-9(17)6-14-8)12-10-3-1-2-4-11(10)15-16-12/h1-4,8-9,14H,5-7H2,(H,15,16) |
| InChIKey | OOCUZWKKVFYFFN-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |