C14H32N4S — CID 111611752
1-[2-[butan-2-yl(methyl)amino]ethyl]-2-methyl-3-(2-methyl-2-methylsulfanylpropyl)guanidine (PubChem CID 111611752) has the molecular formula C14H32N4S and a molecular weight of 288.50 g/mol. Its IUPAC name is 1-[2-[butan-2-yl(methyl)amino]ethyl]-2-methyl-3-(2-methyl-2-methylsulfanylpropyl)guanidine.
| Compound Name | 1-[2-[butan-2-yl(methyl)amino]ethyl]-2-methyl-3-(2-methyl-2-methylsulfanylpropyl)guanidine |
|---|---|
| PubChem CID | 111611752 |
| Molecular Formula | C14H32N4S |
| Molecular Weight | 288.50 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | 1-[2-[butan-2-yl(methyl)amino]ethyl]-2-methyl-3-(2-methyl-2-methylsulfanylpropyl)guanidine |
| SMILES | CCC(C)N(C)CCN/C(=N\C)NCC(C)(C)SC |
| InChI | InChI=1S/C14H32N4S/c1-8-12(2)18(6)10-9-16-13(15-5)17-11-14(3,4)19-7/h12H,8-11H2,1-7H3,(H2,15,16,17) |
| InChIKey | XBSYSVKGEOYBSE-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.50 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|