C18H28N4S — CID 111612022
2-methyl-1-[2-(2-methyl-1H-indol-3-yl)ethyl]-3-(2-methyl-2-methylsulfanylpropyl)guanidine (PubChem CID 111612022) has the molecular formula C18H28N4S and a molecular weight of 332.52 g/mol. Its IUPAC name is 2-methyl-1-[2-(2-methyl-1H-indol-3-yl)ethyl]-3-(2-methyl-2-methylsulfanylpropyl)guanidine.
| Compound Name | 2-methyl-1-[2-(2-methyl-1H-indol-3-yl)ethyl]-3-(2-methyl-2-methylsulfanylpropyl)guanidine |
|---|---|
| PubChem CID | 111612022 |
| Molecular Formula | C18H28N4S |
| Molecular Weight | 332.52 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 2-methyl-1-[2-(2-methyl-1H-indol-3-yl)ethyl]-3-(2-methyl-2-methylsulfanylpropyl)guanidine |
| SMILES | C/N=C(/NCCc1c(C)[nH]c2ccccc12)NCC(C)(C)SC |
| InChI | InChI=1S/C18H28N4S/c1-13-14(15-8-6-7-9-16(15)22-13)10-11-20-17(19-4)21-12-18(2,3)23-5/h6-9,22H,10-12H2,1-5H3,(H2,19,20,21) |
| InChIKey | XSLIKWMDYDPSSW-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 52.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.52 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|