C18H29IN4S — CID 111629449
2-methyl-1-[2-(2-methyl-1H-indol-3-yl)ethyl]-3-(4-methylsulfanylbutyl)guanidine;hydroiodide (PubChem CID 111629449) has the molecular formula C18H29IN4S and a molecular weight of 460.43 g/mol. Its IUPAC name is 2-methyl-1-[2-(2-methyl-1H-indol-3-yl)ethyl]-3-(4-methylsulfanylbutyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[2-(2-methyl-1H-indol-3-yl)ethyl]-3-(4-methylsulfanylbutyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111629449 |
| Molecular Formula | C18H29IN4S |
| Molecular Weight | 460.43 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | 2-methyl-1-[2-(2-methyl-1H-indol-3-yl)ethyl]-3-(4-methylsulfanylbutyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCCSC)NCCc1c(C)[nH]c2ccccc12.I |
| InChI | InChI=1S/C18H28N4S.HI/c1-14-15(16-8-4-5-9-17(16)22-14)10-12-21-18(19-2)20-11-6-7-13-23-3;/h4-5,8-9,22H,6-7,10-13H2,1-3H3,(H2,19,20,21);1H |
| InChIKey | BNKWRIOIBPSEFN-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 52.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.43 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|