C22H29FN4O3S — CID 111613447
2-[[[ethylamino-[2-(4-methylsulfonylphenyl)ethylamino]methylidene]amino]methyl]-3-(4-fluorophenyl)propanamide (PubChem CID 111613447) has the molecular formula C22H29FN4O3S and a molecular weight of 448.56 g/mol. Its IUPAC name is 2-[[[ethylamino-[2-(4-methylsulfonylphenyl)ethylamino]methylidene]amino]methyl]-3-(4-fluorophenyl)propanamide.
| Compound Name | 2-[[[ethylamino-[2-(4-methylsulfonylphenyl)ethylamino]methylidene]amino]methyl]-3-(4-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 111613447 |
| Molecular Formula | C22H29FN4O3S |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | 2-[[[ethylamino-[2-(4-methylsulfonylphenyl)ethylamino]methylidene]amino]methyl]-3-(4-fluorophenyl)propanamide |
| SMILES | CCN/C(=N\CC(Cc1ccc(F)cc1)C(N)=O)NCCc1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C22H29FN4O3S/c1-3-25-22(26-13-12-16-6-10-20(11-7-16)31(2,29)30)27-15-18(21(24)28)14-17-4-8-19(23)9-5-17/h4-11,18H,3,12-15H2,1-2H3,(H2,24,28)(H2,25,26,27) |
| InChIKey | CXGWUKVBMREFHS-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 113.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|