C22H32IN3O2S — CID 111613693
2-methyl-1-[2-methyl-2-(3-methylphenyl)propyl]-3-[2-(4-methylsulfonylphenyl)ethyl]guanidine;hydroiodide (PubChem CID 111613693) has the molecular formula C22H32IN3O2S and a molecular weight of 529.49 g/mol. Its IUPAC name is 2-methyl-1-[2-methyl-2-(3-methylphenyl)propyl]-3-[2-(4-methylsulfonylphenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[2-methyl-2-(3-methylphenyl)propyl]-3-[2-(4-methylsulfonylphenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111613693 |
| Molecular Formula | C22H32IN3O2S |
| Molecular Weight | 529.49 g/mol |
| Exact Mass | 529.13 |
| IUPAC Name | 2-methyl-1-[2-methyl-2-(3-methylphenyl)propyl]-3-[2-(4-methylsulfonylphenyl)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1ccc(S(C)(=O)=O)cc1)NCC(C)(C)c1cccc(C)c1.I |
| InChI | InChI=1S/C22H31N3O2S.HI/c1-17-7-6-8-19(15-17)22(2,3)16-25-21(23-4)24-14-13-18-9-11-20(12-10-18)28(5,26)27;/h6-12,15H,13-14,16H2,1-5H3,(H2,23,24,25);1H |
| InChIKey | TWNJIJOOMWRAEQ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.49 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|