C17H19F3N4S — CID 111617167
1-ethyl-3-(2-phenylcyclopropyl)-2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine (PubChem CID 111617167) has the molecular formula C17H19F3N4S and a molecular weight of 368.43 g/mol. Its IUPAC name is 1-ethyl-3-(2-phenylcyclopropyl)-2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine.
| Compound Name | 1-ethyl-3-(2-phenylcyclopropyl)-2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111617167 |
| Molecular Formula | C17H19F3N4S |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 1-ethyl-3-(2-phenylcyclopropyl)-2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1nc(C(F)(F)F)cs1)NC1CC1c1ccccc1 |
| InChI | InChI=1S/C17H19F3N4S/c1-2-21-16(22-9-15-24-14(10-25-15)17(18,19)20)23-13-8-12(13)11-6-4-3-5-7-11/h3-7,10,12-13H,2,8-9H2,1H3,(H2,21,22,23) |
| InChIKey | PSEUQRDJYZRTNN-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|