C14H22N2O3S — CID 111617527
1-(2-hydroxy-4-methylpentyl)-3-(4-methylsulfinylphenyl)urea (PubChem CID 111617527) has the molecular formula C14H22N2O3S and a molecular weight of 298.41 g/mol. Its IUPAC name is 1-(2-hydroxy-4-methylpentyl)-3-(4-methylsulfinylphenyl)urea.
| Compound Name | 1-(2-hydroxy-4-methylpentyl)-3-(4-methylsulfinylphenyl)urea |
|---|---|
| PubChem CID | 111617527 |
| Molecular Formula | C14H22N2O3S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 1-(2-hydroxy-4-methylpentyl)-3-(4-methylsulfinylphenyl)urea |
| SMILES | CC(C)CC(O)CNC(=O)Nc1ccc(S(C)=O)cc1 |
| InChI | InChI=1S/C14H22N2O3S/c1-10(2)8-12(17)9-15-14(18)16-11-4-6-13(7-5-11)20(3)19/h4-7,10,12,17H,8-9H2,1-3H3,(H2,15,16,18) |
| InChIKey | PLNPWUTYEUNHDD-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |