C20H31N3O5S — CID 78098329
tert-butyl 2-[[4-methyl-2-[(4-methylsulfinylphenyl)carbamoylamino]pentanoyl]amino]acetate (PubChem CID 78098329) has the molecular formula C20H31N3O5S and a molecular weight of 425.55 g/mol. Its IUPAC name is tert-butyl 2-[[4-methyl-2-[(4-methylsulfinylphenyl)carbamoylamino]pentanoyl]amino]acetate.
| Compound Name | tert-butyl 2-[[4-methyl-2-[(4-methylsulfinylphenyl)carbamoylamino]pentanoyl]amino]acetate |
|---|---|
| PubChem CID | 78098329 |
| Molecular Formula | C20H31N3O5S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | tert-butyl 2-[[4-methyl-2-[(4-methylsulfinylphenyl)carbamoylamino]pentanoyl]amino]acetate |
| SMILES | CC(C)CC(NC(=O)Nc1ccc(S(C)=O)cc1)C(=O)NCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H31N3O5S/c1-13(2)11-16(18(25)21-12-17(24)28-20(3,4)5)23-19(26)22-14-7-9-15(10-8-14)29(6)27/h7-10,13,16H,11-12H2,1-6H3,(H,21,25)(H2,22,23,26) |
| InChIKey | YBFMNRNNNFBARP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |