C15H18ClFN2O2S — CID 111618967
1-[2-(2-chloro-6-fluorophenyl)cyclopropyl]-3-[(3-hydroxythiolan-3-yl)methyl]urea (PubChem CID 111618967) has the molecular formula C15H18ClFN2O2S and a molecular weight of 344.84 g/mol. Its IUPAC name is 1-[2-(2-chloro-6-fluorophenyl)cyclopropyl]-3-[(3-hydroxythiolan-3-yl)methyl]urea.
| Compound Name | 1-[2-(2-chloro-6-fluorophenyl)cyclopropyl]-3-[(3-hydroxythiolan-3-yl)methyl]urea |
|---|---|
| PubChem CID | 111618967 |
| Molecular Formula | C15H18ClFN2O2S |
| Molecular Weight | 344.84 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 1-[2-(2-chloro-6-fluorophenyl)cyclopropyl]-3-[(3-hydroxythiolan-3-yl)methyl]urea |
| SMILES | O=C(NCC1(O)CCSC1)NC1CC1c1c(F)cccc1Cl |
| InChI | InChI=1S/C15H18ClFN2O2S/c16-10-2-1-3-11(17)13(10)9-6-12(9)19-14(20)18-7-15(21)4-5-22-8-15/h1-3,9,12,21H,4-8H2,(H2,18,19,20) |
| InChIKey | SNXKIPHTKIYAKK-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.84 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |