C16H13ClF2N2O — CID 97077156
1-(3-chlorophenyl)-3-[(1R,2R)-2-(2,6-difluorophenyl)cyclopropyl]urea (PubChem CID 97077156) has the molecular formula C16H13ClF2N2O and a molecular weight of 322.74 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[(1R,2R)-2-(2,6-difluorophenyl)cyclopropyl]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[(1R,2R)-2-(2,6-difluorophenyl)cyclopropyl]urea |
|---|---|
| PubChem CID | 97077156 |
| Molecular Formula | C16H13ClF2N2O |
| Molecular Weight | 322.74 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[(1R,2R)-2-(2,6-difluorophenyl)cyclopropyl]urea |
| SMILES | O=C(Nc1cccc(Cl)c1)N[C@@H]1C[C@@H]1c1c(F)cccc1F |
| InChI | InChI=1S/C16H13ClF2N2O/c17-9-3-1-4-10(7-9)20-16(22)21-14-8-11(14)15-12(18)5-2-6-13(15)19/h1-7,11,14H,8H2,(H2,20,21,22)/t11-,14+/m0/s1 |
| InChIKey | LLDPMJZKMYPPMK-SMDDNHRTSA-N |
| XLogP | 4.30 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.74 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |