C16H20F2N2O2 — CID 111422308
1-[2-(2,6-difluorophenyl)cyclopropyl]-3-(4-hydroxycyclohexyl)urea (PubChem CID 111422308) has the molecular formula C16H20F2N2O2 and a molecular weight of 310.34 g/mol. Its IUPAC name is 1-[2-(2,6-difluorophenyl)cyclopropyl]-3-(4-hydroxycyclohexyl)urea.
| Compound Name | 1-[2-(2,6-difluorophenyl)cyclopropyl]-3-(4-hydroxycyclohexyl)urea |
|---|---|
| PubChem CID | 111422308 |
| Molecular Formula | C16H20F2N2O2 |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 1-[2-(2,6-difluorophenyl)cyclopropyl]-3-(4-hydroxycyclohexyl)urea |
| SMILES | O=C(NC1CCC(O)CC1)NC1CC1c1c(F)cccc1F |
| InChI | InChI=1S/C16H20F2N2O2/c17-12-2-1-3-13(18)15(12)11-8-14(11)20-16(22)19-9-4-6-10(21)7-5-9/h1-3,9-11,14,21H,4-8H2,(H2,19,20,22) |
| InChIKey | WVELJRFRTOMIJM-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |