C15H19FN2O2 — CID 128682857
1-[(1R,2S)-2-(2-fluorophenyl)cyclopropyl]-3-[(3S)-oxan-3-yl]urea (PubChem CID 128682857) has the molecular formula C15H19FN2O2 and a molecular weight of 278.33 g/mol. Its IUPAC name is 1-[(1R,2S)-2-(2-fluorophenyl)cyclopropyl]-3-[(3S)-oxan-3-yl]urea.
| Compound Name | 1-[(1R,2S)-2-(2-fluorophenyl)cyclopropyl]-3-[(3S)-oxan-3-yl]urea |
|---|---|
| PubChem CID | 128682857 |
| Molecular Formula | C15H19FN2O2 |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 1-[(1R,2S)-2-(2-fluorophenyl)cyclopropyl]-3-[(3S)-oxan-3-yl]urea |
| SMILES | O=C(N[C@H]1CCCOC1)N[C@@H]1C[C@H]1c1ccccc1F |
| InChI | InChI=1S/C15H19FN2O2/c16-13-6-2-1-5-11(13)12-8-14(12)18-15(19)17-10-4-3-7-20-9-10/h1-2,5-6,10,12,14H,3-4,7-9H2,(H2,17,18,19)/t10-,12-,14+/m0/s1 |
| InChIKey | ZNRWVJDKNLIXCF-VHRBIJSZSA-N |
| XLogP | 2.16 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |