C19H30IN5 — CID 111619240
1-(2,2-dimethyl-3-phenylpropyl)-2-methyl-3-(3-pyrazol-1-ylpropyl)guanidine;hydroiodide (PubChem CID 111619240) has the molecular formula C19H30IN5 and a molecular weight of 455.39 g/mol. Its IUPAC name is 1-(2,2-dimethyl-3-phenylpropyl)-2-methyl-3-(3-pyrazol-1-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-(2,2-dimethyl-3-phenylpropyl)-2-methyl-3-(3-pyrazol-1-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111619240 |
| Molecular Formula | C19H30IN5 |
| Molecular Weight | 455.39 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | 1-(2,2-dimethyl-3-phenylpropyl)-2-methyl-3-(3-pyrazol-1-ylpropyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCn1cccn1)NCC(C)(C)Cc1ccccc1.I |
| InChI | InChI=1S/C19H29N5.HI/c1-19(2,15-17-9-5-4-6-10-17)16-22-18(20-3)21-11-7-13-24-14-8-12-23-24;/h4-6,8-10,12,14H,7,11,13,15-16H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | VOGXKIVYBRWPHN-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.39 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|