C22H32IN3OS — CID 111619919
1-ethyl-3-[[2-(4-methylphenyl)oxan-3-yl]methyl]-2-[(5-methylthiophen-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111619919) has the molecular formula C22H32IN3OS and a molecular weight of 513.49 g/mol. Its IUPAC name is 1-ethyl-3-[[2-(4-methylphenyl)oxan-3-yl]methyl]-2-[(5-methylthiophen-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[[2-(4-methylphenyl)oxan-3-yl]methyl]-2-[(5-methylthiophen-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111619919 |
| Molecular Formula | C22H32IN3OS |
| Molecular Weight | 513.49 g/mol |
| Exact Mass | 513.13 |
| IUPAC Name | 1-ethyl-3-[[2-(4-methylphenyl)oxan-3-yl]methyl]-2-[(5-methylthiophen-2-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(C)s1)NCC1CCCOC1c1ccc(C)cc1.I |
| InChI | InChI=1S/C22H31N3OS.HI/c1-4-23-22(25-15-20-12-9-17(3)27-20)24-14-19-6-5-13-26-21(19)18-10-7-16(2)8-11-18;/h7-12,19,21H,4-6,13-15H2,1-3H3,(H2,23,24,25);1H |
| InChIKey | XRMYRBCVZONYFQ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.49 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|