C24H30N4O2S — CID 111620522
1-ethyl-3-[[2-(4-methylphenyl)oxan-3-yl]methyl]-2-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]guanidine (PubChem CID 111620522) has the molecular formula C24H30N4O2S and a molecular weight of 438.60 g/mol. Its IUPAC name is 1-ethyl-3-[[2-(4-methylphenyl)oxan-3-yl]methyl]-2-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[[2-(4-methylphenyl)oxan-3-yl]methyl]-2-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111620522 |
| Molecular Formula | C24H30N4O2S |
| Molecular Weight | 438.60 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | 1-ethyl-3-[[2-(4-methylphenyl)oxan-3-yl]methyl]-2-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1coc(-c2cccs2)n1)NCC1CCCOC1c1ccc(C)cc1 |
| InChI | InChI=1S/C24H30N4O2S/c1-3-25-24(27-15-20-16-30-23(28-20)21-7-5-13-31-21)26-14-19-6-4-12-29-22(19)18-10-8-17(2)9-11-18/h5,7-11,13,16,19,22H,3-4,6,12,14-15H2,1-2H3,(H2,25,26,27) |
| InChIKey | XIYNDOZYDJRJGC-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 71.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.60 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|