C23H35IN4OS — CID 111620505
2-methyl-1-[[2-(4-methylphenyl)oxan-3-yl]methyl]-3-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide (PubChem CID 111620505) has the molecular formula C23H35IN4OS and a molecular weight of 542.53 g/mol. Its IUPAC name is 2-methyl-1-[[2-(4-methylphenyl)oxan-3-yl]methyl]-3-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[[2-(4-methylphenyl)oxan-3-yl]methyl]-3-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111620505 |
| Molecular Formula | C23H35IN4OS |
| Molecular Weight | 542.53 g/mol |
| Exact Mass | 542.16 |
| IUPAC Name | 2-methyl-1-[[2-(4-methylphenyl)oxan-3-yl]methyl]-3-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1csc(C(C)C)n1)NCC1CCCOC1c1ccc(C)cc1.I |
| InChI | InChI=1S/C23H34N4OS.HI/c1-16(2)22-27-20(15-29-22)11-12-25-23(24-4)26-14-19-6-5-13-28-21(19)18-9-7-17(3)8-10-18;/h7-10,15-16,19,21H,5-6,11-14H2,1-4H3,(H2,24,25,26);1H |
| InChIKey | GEGXWEDIVLOCAX-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.53 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|