C21H38N6O2 — CID 111621420
2-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-1-ethyl-3-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine (PubChem CID 111621420) has the molecular formula C21H38N6O2 and a molecular weight of 406.58 g/mol. Its IUPAC name is 2-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-1-ethyl-3-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine.
| Compound Name | 2-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-1-ethyl-3-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine |
|---|---|
| PubChem CID | 111621420 |
| Molecular Formula | C21H38N6O2 |
| Molecular Weight | 406.58 g/mol |
| Exact Mass | 406.31 |
| IUPAC Name | 2-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-1-ethyl-3-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1noc(C(C)(C)C)n1)NCC1(N2CCOCC2)CCCCC1 |
| InChI | InChI=1S/C21H38N6O2/c1-5-22-19(23-15-17-25-18(29-26-17)20(2,3)4)24-16-21(9-7-6-8-10-21)27-11-13-28-14-12-27/h5-16H2,1-4H3,(H2,22,23,24) |
| InChIKey | RUEVEIOXAYAWTR-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 87.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.58 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|