C16H12FN3O2 — CID 11162289
N-[4-[2-cyano-2-(4-fluorophenyl)acetyl]-2-pyridinyl]acetamide (PubChem CID 11162289) has the molecular formula C16H12FN3O2 and a molecular weight of 297.29 g/mol. Its IUPAC name is N-[4-[2-cyano-2-(4-fluorophenyl)acetyl]-2-pyridinyl]acetamide.
| Compound Name | N-[4-[2-cyano-2-(4-fluorophenyl)acetyl]-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 11162289 |
| Molecular Formula | C16H12FN3O2 |
| Molecular Weight | 297.29 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | N-[4-[2-cyano-2-(4-fluorophenyl)acetyl]-2-pyridinyl]acetamide |
| SMILES | CC(=O)Nc1cc(C(=O)C(C#N)c2ccc(F)cc2)ccn1 |
| InChI | InChI=1S/C16H12FN3O2/c1-10(21)20-15-8-12(6-7-19-15)16(22)14(9-18)11-2-4-13(17)5-3-11/h2-8,14H,1H3,(H,19,20,21) |
| InChIKey | WRAMFBNOYKKPPJ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.29 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |