C15H11F2NO2 — CID 59067792
2-(4-fluorophenyl)-1-(2-fluoro-4-pyridinyl)butane-1,3-dione (PubChem CID 59067792) has the molecular formula C15H11F2NO2 and a molecular weight of 275.25 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-1-(2-fluoro-4-pyridinyl)butane-1,3-dione.
| Compound Name | 2-(4-fluorophenyl)-1-(2-fluoro-4-pyridinyl)butane-1,3-dione |
|---|---|
| PubChem CID | 59067792 |
| Molecular Formula | C15H11F2NO2 |
| Molecular Weight | 275.25 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 2-(4-fluorophenyl)-1-(2-fluoro-4-pyridinyl)butane-1,3-dione |
| SMILES | CC(=O)C(C(=O)c1ccnc(F)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H11F2NO2/c1-9(19)14(10-2-4-12(16)5-3-10)15(20)11-6-7-18-13(17)8-11/h2-8,14H,1H3 |
| InChIKey | UZQWBYKGGSVLAG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.25 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|