C25H36N4O2 — CID 111624270
1-[(2-tert-butyloxan-3-yl)methyl]-2-methyl-3-[(2-phenylmethoxy-3-pyridinyl)methyl]guanidine (PubChem CID 111624270) has the molecular formula C25H36N4O2 and a molecular weight of 424.59 g/mol. Its IUPAC name is 1-[(2-tert-butyloxan-3-yl)methyl]-2-methyl-3-[(2-phenylmethoxy-3-pyridinyl)methyl]guanidine.
| Compound Name | 1-[(2-tert-butyloxan-3-yl)methyl]-2-methyl-3-[(2-phenylmethoxy-3-pyridinyl)methyl]guanidine |
|---|---|
| PubChem CID | 111624270 |
| Molecular Formula | C25H36N4O2 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | 1-[(2-tert-butyloxan-3-yl)methyl]-2-methyl-3-[(2-phenylmethoxy-3-pyridinyl)methyl]guanidine |
| SMILES | C/N=C(\NCc1cccnc1OCc1ccccc1)NCC1CCCOC1C(C)(C)C |
| InChI | InChI=1S/C25H36N4O2/c1-25(2,3)22-20(13-9-15-30-22)16-28-24(26-4)29-17-21-12-8-14-27-23(21)31-18-19-10-6-5-7-11-19/h5-8,10-12,14,20,22H,9,13,15-18H2,1-4H3,(H2,26,28,29) |
| InChIKey | LHCSYSZTHBNQCQ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|