C25H29N5O2 — CID 111872927
N,N-dimethyl-4-[[[N'-methyl-N-[(2-phenylmethoxy-3-pyridinyl)methyl]carbamimidoyl]amino]methyl]benzamide (PubChem CID 111872927) has the molecular formula C25H29N5O2 and a molecular weight of 431.54 g/mol. Its IUPAC name is N,N-dimethyl-4-[[[N'-methyl-N-[(2-phenylmethoxy-3-pyridinyl)methyl]carbamimidoyl]amino]methyl]benzamide.
| Compound Name | N,N-dimethyl-4-[[[N'-methyl-N-[(2-phenylmethoxy-3-pyridinyl)methyl]carbamimidoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 111872927 |
| Molecular Formula | C25H29N5O2 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | N,N-dimethyl-4-[[[N'-methyl-N-[(2-phenylmethoxy-3-pyridinyl)methyl]carbamimidoyl]amino]methyl]benzamide |
| SMILES | C/N=C(/NCc1ccc(C(=O)N(C)C)cc1)NCc1cccnc1OCc1ccccc1 |
| InChI | InChI=1S/C25H29N5O2/c1-26-25(28-16-19-11-13-21(14-12-19)24(31)30(2)3)29-17-22-10-7-15-27-23(22)32-18-20-8-5-4-6-9-20/h4-15H,16-18H2,1-3H3,(H2,26,28,29) |
| InChIKey | NWOBALXNSITGHC-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|