C26H31IN4O2 — CID 111874948
N,N-dimethyl-4-[[[N'-methyl-N-[[4-(phenoxymethyl)phenyl]methyl]carbamimidoyl]amino]methyl]benzamide;hydroiodide (PubChem CID 111874948) has the molecular formula C26H31IN4O2 and a molecular weight of 558.46 g/mol. Its IUPAC name is N,N-dimethyl-4-[[[N'-methyl-N-[[4-(phenoxymethyl)phenyl]methyl]carbamimidoyl]amino]methyl]benzamide;hydroiodide.
| Compound Name | N,N-dimethyl-4-[[[N'-methyl-N-[[4-(phenoxymethyl)phenyl]methyl]carbamimidoyl]amino]methyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111874948 |
| Molecular Formula | C26H31IN4O2 |
| Molecular Weight | 558.46 g/mol |
| Exact Mass | 558.15 |
| IUPAC Name | N,N-dimethyl-4-[[[N'-methyl-N-[[4-(phenoxymethyl)phenyl]methyl]carbamimidoyl]amino]methyl]benzamide;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(COc2ccccc2)cc1)NCc1ccc(C(=O)N(C)C)cc1.I |
| InChI | InChI=1S/C26H30N4O2.HI/c1-27-26(29-18-21-13-15-23(16-14-21)25(31)30(2)3)28-17-20-9-11-22(12-10-20)19-32-24-7-5-4-6-8-24;/h4-16H,17-19H2,1-3H3,(H2,27,28,29);1H |
| InChIKey | VLUUCLGCFAETCI-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.46 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|