About henicosa-2,19-diyn-11-one
henicosa-2,19-diyn-11-one (PubChem CID 11162465) has the molecular formula C21H34O
and a molecular weight of 302.50 g/mol. Its IUPAC name is henicosa-2,19-diyn-11-one.
Molecular Properties
| Compound Name | henicosa-2,19-diyn-11-one |
| PubChem CID | 11162465 |
| Molecular Formula | C21H34O |
| Molecular Weight | 302.50 g/mol |
| Exact Mass | 302.26 |
| IUPAC Name | henicosa-2,19-diyn-11-one |
| SMILES | CC#CCCCCCCCC(=O)CCCCCCCC#CC |
| InChI | InChI=1S/C21H34O/c1-3-5-7-9-11-13-15-17-19-21(22)20-18-16-14-12-10-8-6-4-2/h7-20H2,1-2H3 |
| InChIKey | SDGRPRKFYHHDOW-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 302.50 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze henicosa-2,19-diyn-11-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of henicosa-2,19-diyn-11-one?
The IUPAC name of henicosa-2,19-diyn-11-one (CID 11162465) is henicosa-2,19-diyn-11-one.
What is the SMILES notation for henicosa-2,19-diyn-11-one?
The canonical SMILES for henicosa-2,19-diyn-11-one is CC#CCCCCCCCC(=O)CCCCCCCC#CC.
What is the InChIKey of henicosa-2,19-diyn-11-one?
The InChIKey is SDGRPRKFYHHDOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H34O/c1-3-5-7-9-11-13-15-17-19-21(22)20-18-16-14-12-10-8-6-4-2/h7-20H2,1-2H3.
What are the key properties of henicosa-2,19-diyn-11-one?
henicosa-2,19-diyn-11-one has a molecular weight of 302.50 g/mol, XLogP of 6.06, 14 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for henicosa-2,19-diyn-11-one is sourced from PubChem (CID 11162465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).