About nonadecan-10-one
nonadecan-10-one (PubChem CID 10441) has the molecular formula C19H38O
and a molecular weight of 282.51 g/mol. Its IUPAC name is nonadecan-10-one.
Molecular Properties
| Compound Name | nonadecan-10-one |
| PubChem CID | 10441 |
| Molecular Formula | C19H38O |
| Molecular Weight | 282.51 g/mol |
| Exact Mass | 282.29 |
| IUPAC Name | nonadecan-10-one |
| SMILES | CCCCCCCCCC(=O)CCCCCCCCC |
| InChI | InChI=1S/C19H38O/c1-3-5-7-9-11-13-15-17-19(20)18-16-14-12-10-8-6-4-2/h3-18H2,1-2H3 |
| InChIKey | YUPOCHDBBHTUBJ-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 282.51 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze nonadecan-10-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nonadecan-10-one?
The IUPAC name of nonadecan-10-one (CID 10441) is nonadecan-10-one.
What is the SMILES notation for nonadecan-10-one?
The canonical SMILES for nonadecan-10-one is CCCCCCCCCC(=O)CCCCCCCCC.
What is the InChIKey of nonadecan-10-one?
The InChIKey is YUPOCHDBBHTUBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H38O/c1-3-5-7-9-11-13-15-17-19(20)18-16-14-12-10-8-6-4-2/h3-18H2,1-2H3.
What are the key properties of nonadecan-10-one?
nonadecan-10-one has a molecular weight of 282.51 g/mol, XLogP of 6.84, 16 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for nonadecan-10-one is sourced from PubChem (CID 10441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).