C18H38N4S — CID 111626720
2-methyl-1-[3-methyl-2-(4-methylpiperidin-1-yl)butyl]-3-(4-methylsulfanylbutyl)guanidine (PubChem CID 111626720) has the molecular formula C18H38N4S and a molecular weight of 342.60 g/mol. Its IUPAC name is 2-methyl-1-[3-methyl-2-(4-methylpiperidin-1-yl)butyl]-3-(4-methylsulfanylbutyl)guanidine.
| Compound Name | 2-methyl-1-[3-methyl-2-(4-methylpiperidin-1-yl)butyl]-3-(4-methylsulfanylbutyl)guanidine |
|---|---|
| PubChem CID | 111626720 |
| Molecular Formula | C18H38N4S |
| Molecular Weight | 342.60 g/mol |
| Exact Mass | 342.28 |
| IUPAC Name | 2-methyl-1-[3-methyl-2-(4-methylpiperidin-1-yl)butyl]-3-(4-methylsulfanylbutyl)guanidine |
| SMILES | C/N=C(\NCCCCSC)NCC(C(C)C)N1CCC(C)CC1 |
| InChI | InChI=1S/C18H38N4S/c1-15(2)17(22-11-8-16(3)9-12-22)14-21-18(19-4)20-10-6-7-13-23-5/h15-17H,6-14H2,1-5H3,(H2,19,20,21) |
| InChIKey | JZAVDDAQABGMNU-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.60 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|