C19H33N3OS — CID 111628108
1-ethyl-3-(4-methylsulfanylbutyl)-2-[[3-(propan-2-yloxymethyl)phenyl]methyl]guanidine (PubChem CID 111628108) has the molecular formula C19H33N3OS and a molecular weight of 351.56 g/mol. Its IUPAC name is 1-ethyl-3-(4-methylsulfanylbutyl)-2-[[3-(propan-2-yloxymethyl)phenyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-(4-methylsulfanylbutyl)-2-[[3-(propan-2-yloxymethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111628108 |
| Molecular Formula | C19H33N3OS |
| Molecular Weight | 351.56 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | 1-ethyl-3-(4-methylsulfanylbutyl)-2-[[3-(propan-2-yloxymethyl)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccc(COC(C)C)c1)NCCCCSC |
| InChI | InChI=1S/C19H33N3OS/c1-5-20-19(21-11-6-7-12-24-4)22-14-17-9-8-10-18(13-17)15-23-16(2)3/h8-10,13,16H,5-7,11-12,14-15H2,1-4H3,(H2,20,21,22) |
| InChIKey | FIUDANQMYUGWAU-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.56 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|