C16H26IN3O2S — CID 111628427
methyl 4-[[[N'-methyl-N-(4-methylsulfanylbutyl)carbamimidoyl]amino]methyl]benzoate;hydroiodide (PubChem CID 111628427) has the molecular formula C16H26IN3O2S and a molecular weight of 451.37 g/mol. Its IUPAC name is methyl 4-[[[N'-methyl-N-(4-methylsulfanylbutyl)carbamimidoyl]amino]methyl]benzoate;hydroiodide.
| Compound Name | methyl 4-[[[N'-methyl-N-(4-methylsulfanylbutyl)carbamimidoyl]amino]methyl]benzoate;hydroiodide |
|---|---|
| PubChem CID | 111628427 |
| Molecular Formula | C16H26IN3O2S |
| Molecular Weight | 451.37 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | methyl 4-[[[N'-methyl-N-(4-methylsulfanylbutyl)carbamimidoyl]amino]methyl]benzoate;hydroiodide |
| SMILES | C/N=C(\NCCCCSC)NCc1ccc(C(=O)OC)cc1.I |
| InChI | InChI=1S/C16H25N3O2S.HI/c1-17-16(18-10-4-5-11-22-3)19-12-13-6-8-14(9-7-13)15(20)21-2;/h6-9H,4-5,10-12H2,1-3H3,(H2,17,18,19);1H |
| InChIKey | GWLMSYNTLCPFGO-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.37 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|