C17H28N4OS — CID 111628536
N-ethyl-4-[[[N'-methyl-N-(4-methylsulfanylbutyl)carbamimidoyl]amino]methyl]benzamide (PubChem CID 111628536) has the molecular formula C17H28N4OS and a molecular weight of 336.51 g/mol. Its IUPAC name is N-ethyl-4-[[[N'-methyl-N-(4-methylsulfanylbutyl)carbamimidoyl]amino]methyl]benzamide.
| Compound Name | N-ethyl-4-[[[N'-methyl-N-(4-methylsulfanylbutyl)carbamimidoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 111628536 |
| Molecular Formula | C17H28N4OS |
| Molecular Weight | 336.51 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | N-ethyl-4-[[[N'-methyl-N-(4-methylsulfanylbutyl)carbamimidoyl]amino]methyl]benzamide |
| SMILES | CCNC(=O)c1ccc(CN/C(=N/C)NCCCCSC)cc1 |
| InChI | InChI=1S/C17H28N4OS/c1-4-19-16(22)15-9-7-14(8-10-15)13-21-17(18-2)20-11-5-6-12-23-3/h7-10H,4-6,11-13H2,1-3H3,(H,19,22)(H2,18,20,21) |
| InChIKey | XQVDNFMWYZTXKA-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.51 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|