C13H14BrFN2O3 — CID 111629813
N'-(4-bromo-2-fluorophenyl)-N-[[1-(hydroxymethyl)cyclopropyl]methyl]oxamide (PubChem CID 111629813) has the molecular formula C13H14BrFN2O3 and a molecular weight of 345.17 g/mol. Its IUPAC name is N'-(4-bromo-2-fluorophenyl)-N-[[1-(hydroxymethyl)cyclopropyl]methyl]oxamide.
| Compound Name | N'-(4-bromo-2-fluorophenyl)-N-[[1-(hydroxymethyl)cyclopropyl]methyl]oxamide |
|---|---|
| PubChem CID | 111629813 |
| Molecular Formula | C13H14BrFN2O3 |
| Molecular Weight | 345.17 g/mol |
| Exact Mass | 344.02 |
| IUPAC Name | N'-(4-bromo-2-fluorophenyl)-N-[[1-(hydroxymethyl)cyclopropyl]methyl]oxamide |
| SMILES | O=C(NCC1(CO)CC1)C(=O)Nc1ccc(Br)cc1F |
| InChI | InChI=1S/C13H14BrFN2O3/c14-8-1-2-10(9(15)5-8)17-12(20)11(19)16-6-13(7-18)3-4-13/h1-2,5,18H,3-4,6-7H2,(H,16,19)(H,17,20) |
| InChIKey | BLMPLXZYQTWMQS-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.17 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|