C21H35N5O — CID 111633299
3-[2-[[N-[2-[cyclohexyl(methyl)amino]ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-N-methylbenzamide (PubChem CID 111633299) has the molecular formula C21H35N5O and a molecular weight of 373.55 g/mol. Its IUPAC name is 3-[2-[[N-[2-[cyclohexyl(methyl)amino]ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-N-methylbenzamide.
| Compound Name | 3-[2-[[N-[2-[cyclohexyl(methyl)amino]ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 111633299 |
| Molecular Formula | C21H35N5O |
| Molecular Weight | 373.55 g/mol |
| Exact Mass | 373.28 |
| IUPAC Name | 3-[2-[[N-[2-[cyclohexyl(methyl)amino]ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-N-methylbenzamide |
| SMILES | C/N=C(/NCCc1cccc(C(=O)NC)c1)NCCN(C)C1CCCCC1 |
| InChI | InChI=1S/C21H35N5O/c1-22-20(27)18-9-7-8-17(16-18)12-13-24-21(23-2)25-14-15-26(3)19-10-5-4-6-11-19/h7-9,16,19H,4-6,10-15H2,1-3H3,(H,22,27)(H2,23,24,25) |
| InChIKey | MZBLNVHGWPBZFG-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.55 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|