C24H35IN4O3 — CID 111633760
3-[2-[[N-ethyl-N'-[3-[(4-methoxyphenyl)methoxy]propyl]carbamimidoyl]amino]ethyl]-N-methylbenzamide;hydroiodide (PubChem CID 111633760) has the molecular formula C24H35IN4O3 and a molecular weight of 554.47 g/mol. Its IUPAC name is 3-[2-[[N-ethyl-N'-[3-[(4-methoxyphenyl)methoxy]propyl]carbamimidoyl]amino]ethyl]-N-methylbenzamide;hydroiodide.
| Compound Name | 3-[2-[[N-ethyl-N'-[3-[(4-methoxyphenyl)methoxy]propyl]carbamimidoyl]amino]ethyl]-N-methylbenzamide;hydroiodide |
|---|---|
| PubChem CID | 111633760 |
| Molecular Formula | C24H35IN4O3 |
| Molecular Weight | 554.47 g/mol |
| Exact Mass | 554.18 |
| IUPAC Name | 3-[2-[[N-ethyl-N'-[3-[(4-methoxyphenyl)methoxy]propyl]carbamimidoyl]amino]ethyl]-N-methylbenzamide;hydroiodide |
| SMILES | CCN/C(=N\CCCOCc1ccc(OC)cc1)NCCc1cccc(C(=O)NC)c1.I |
| InChI | InChI=1S/C24H34N4O3.HI/c1-4-26-24(28-15-13-19-7-5-8-21(17-19)23(29)25-2)27-14-6-16-31-18-20-9-11-22(30-3)12-10-20;/h5,7-12,17H,4,6,13-16,18H2,1-3H3,(H,25,29)(H2,26,27,28);1H |
| InChIKey | ZXAIQYJCJAEDMS-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.47 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|