C15H22N4O — CID 111634033
N-methyl-3-[2-[[N'-(2-methylprop-2-enyl)carbamimidoyl]amino]ethyl]benzamide (PubChem CID 111634033) has the molecular formula C15H22N4O and a molecular weight of 274.37 g/mol. Its IUPAC name is N-methyl-3-[2-[[N'-(2-methylprop-2-enyl)carbamimidoyl]amino]ethyl]benzamide.
| Compound Name | N-methyl-3-[2-[[N'-(2-methylprop-2-enyl)carbamimidoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 111634033 |
| Molecular Formula | C15H22N4O |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | N-methyl-3-[2-[[N'-(2-methylprop-2-enyl)carbamimidoyl]amino]ethyl]benzamide |
| SMILES | C=C(C)C/N=C(\N)NCCc1cccc(C(=O)NC)c1 |
| InChI | InChI=1S/C15H22N4O/c1-11(2)10-19-15(16)18-8-7-12-5-4-6-13(9-12)14(20)17-3/h4-6,9H,1,7-8,10H2,2-3H3,(H,17,20)(H3,16,18,19) |
| InChIKey | LKINPWGQUORRKN-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|