C18H28IN5O2 — CID 111634142
3-[2-[[N'-[2-(cyclopropylamino)-2-oxoethyl]-N-ethylcarbamimidoyl]amino]ethyl]-N-methylbenzamide;hydroiodide (PubChem CID 111634142) has the molecular formula C18H28IN5O2 and a molecular weight of 473.36 g/mol. Its IUPAC name is 3-[2-[[N'-[2-(cyclopropylamino)-2-oxoethyl]-N-ethylcarbamimidoyl]amino]ethyl]-N-methylbenzamide;hydroiodide.
| Compound Name | 3-[2-[[N'-[2-(cyclopropylamino)-2-oxoethyl]-N-ethylcarbamimidoyl]amino]ethyl]-N-methylbenzamide;hydroiodide |
|---|---|
| PubChem CID | 111634142 |
| Molecular Formula | C18H28IN5O2 |
| Molecular Weight | 473.36 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | 3-[2-[[N'-[2-(cyclopropylamino)-2-oxoethyl]-N-ethylcarbamimidoyl]amino]ethyl]-N-methylbenzamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)NC1CC1)NCCc1cccc(C(=O)NC)c1.I |
| InChI | InChI=1S/C18H27N5O2.HI/c1-3-20-18(22-12-16(24)23-15-7-8-15)21-10-9-13-5-4-6-14(11-13)17(25)19-2;/h4-6,11,15H,3,7-10,12H2,1-2H3,(H,19,25)(H,23,24)(H2,20,21,22);1H |
| InChIKey | MRWXWJIFIFWZEN-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 94.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.36 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|