C21H34N4O3S — CID 111634829
1-(2,2-dimethyl-4-methylsulfonylbutyl)-3-ethyl-2-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine (PubChem CID 111634829) has the molecular formula C21H34N4O3S and a molecular weight of 422.60 g/mol. Its IUPAC name is 1-(2,2-dimethyl-4-methylsulfonylbutyl)-3-ethyl-2-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine.
| Compound Name | 1-(2,2-dimethyl-4-methylsulfonylbutyl)-3-ethyl-2-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111634829 |
| Molecular Formula | C21H34N4O3S |
| Molecular Weight | 422.60 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | 1-(2,2-dimethyl-4-methylsulfonylbutyl)-3-ethyl-2-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(N2CCCC2=O)cc1)NCC(C)(C)CCS(C)(=O)=O |
| InChI | InChI=1S/C21H34N4O3S/c1-5-22-20(24-16-21(2,3)12-14-29(4,27)28)23-15-17-8-10-18(11-9-17)25-13-6-7-19(25)26/h8-11H,5-7,12-16H2,1-4H3,(H2,22,23,24) |
| InChIKey | CEPOMCYIWJUJOU-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.60 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|