C22H38N4O2S — CID 111634961
1-(2,2-dimethyl-4-methylsulfonylbutyl)-3-ethyl-2-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]guanidine (PubChem CID 111634961) has the molecular formula C22H38N4O2S and a molecular weight of 422.64 g/mol. Its IUPAC name is 1-(2,2-dimethyl-4-methylsulfonylbutyl)-3-ethyl-2-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]guanidine.
| Compound Name | 1-(2,2-dimethyl-4-methylsulfonylbutyl)-3-ethyl-2-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111634961 |
| Molecular Formula | C22H38N4O2S |
| Molecular Weight | 422.64 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | 1-(2,2-dimethyl-4-methylsulfonylbutyl)-3-ethyl-2-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(CN2CCCC2)cc1)NCC(C)(C)CCS(C)(=O)=O |
| InChI | InChI=1S/C22H38N4O2S/c1-5-23-21(25-18-22(2,3)12-15-29(4,27)28)24-16-19-8-10-20(11-9-19)17-26-13-6-7-14-26/h8-11H,5-7,12-18H2,1-4H3,(H2,23,24,25) |
| InChIKey | NMNHVQLRVJEKEG-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.64 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|